About N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine
N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine (PubChem CID 155228875) has the molecular formula C21H19F2N5O2S
and a molecular weight of 443.48 g/mol. Its IUPAC name is N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine.
Molecular Properties
| Compound Name | N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine |
| PubChem CID | 155228875 |
| Molecular Formula | C21H19F2N5O2S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine |
| SMILES | Cc1ccc(F)c(Cn2cnc3c(NCc4ccccc4)nc(S(C)(=O)=O)nc32)c1F |
| InChI | InChI=1S/C21H19F2N5O2S/c1-13-8-9-16(22)15(17(13)23)11-28-12-25-18-19(24-10-14-6-4-3-5-7-14)26-21(27-20(18)28)31(2,29)30/h3-9,12H,10-11H2,1-2H3,(H,24,26,27) |
| InChIKey | QSJXSGSKWSVBAW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine?
The IUPAC name of N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine (CID 155228875) is N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine.
What is the SMILES notation for N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine?
The canonical SMILES for N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine is Cc1ccc(F)c(Cn2cnc3c(NCc4ccccc4)nc(S(C)(=O)=O)nc32)c1F.
What is the InChIKey of N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine?
The InChIKey is QSJXSGSKWSVBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N5O2S/c1-13-8-9-16(22)15(17(13)23)11-28-12-25-18-19(24-10-14-6-4-3-5-7-14)26-21(27-20(18)28)31(2,29)30/h3-9,12H,10-11H2,1-2H3,(H,24,26,27).
What are the key properties of N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine?
N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine has a molecular weight of 443.48 g/mol, XLogP of 3.48, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine is sourced from PubChem (CID 155228875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).