C21H19F2N5O2S — CID 155228875
N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine (PubChem CID 155228875) has the molecular formula C21H19F2N5O2S and a molecular weight of 443.48 g/mol. Its IUPAC name is N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine.
| Compound Name | N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine |
|---|---|
| PubChem CID | 155228875 |
| Molecular Formula | C21H19F2N5O2S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-benzyl-9-[(2,6-difluoro-3-methylphenyl)methyl]-2-methylsulfonylpurin-6-amine |
| SMILES | Cc1ccc(F)c(Cn2cnc3c(NCc4ccccc4)nc(S(C)(=O)=O)nc32)c1F |
| InChI | InChI=1S/C21H19F2N5O2S/c1-13-8-9-16(22)15(17(13)23)11-28-12-25-18-19(24-10-14-6-4-3-5-7-14)26-21(27-20(18)28)31(2,29)30/h3-9,12H,10-11H2,1-2H3,(H,24,26,27) |
| InChIKey | QSJXSGSKWSVBAW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |