C19H14ClN7 — CID 24778443
6-[(4-chlorophenyl)methylamino]-9-(pyridin-3-ylmethyl)purine-2-carbonitrile (PubChem CID 24778443) has the molecular formula C19H14ClN7 and a molecular weight of 375.82 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methylamino]-9-(pyridin-3-ylmethyl)purine-2-carbonitrile.
| Compound Name | 6-[(4-chlorophenyl)methylamino]-9-(pyridin-3-ylmethyl)purine-2-carbonitrile |
|---|---|
| PubChem CID | 24778443 |
| Molecular Formula | C19H14ClN7 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 6-[(4-chlorophenyl)methylamino]-9-(pyridin-3-ylmethyl)purine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2ccc(Cl)cc2)c2ncn(Cc3cccnc3)c2n1 |
| InChI | InChI=1S/C19H14ClN7/c20-15-5-3-13(4-6-15)10-23-18-17-19(26-16(8-21)25-18)27(12-24-17)11-14-2-1-7-22-9-14/h1-7,9,12H,10-11H2,(H,23,25,26) |
| InChIKey | SZXMCUMCONYTJU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |