C22H19ClN6O — CID 44583522
6-[[4-(3-chlorophenyl)phenyl]methylamino]-9-(3-hydroxypropyl)purine-2-carbonitrile (PubChem CID 44583522) has the molecular formula C22H19ClN6O and a molecular weight of 418.89 g/mol. Its IUPAC name is 6-[[4-(3-chlorophenyl)phenyl]methylamino]-9-(3-hydroxypropyl)purine-2-carbonitrile.
| Compound Name | 6-[[4-(3-chlorophenyl)phenyl]methylamino]-9-(3-hydroxypropyl)purine-2-carbonitrile |
|---|---|
| PubChem CID | 44583522 |
| Molecular Formula | C22H19ClN6O |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 6-[[4-(3-chlorophenyl)phenyl]methylamino]-9-(3-hydroxypropyl)purine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2ccc(-c3cccc(Cl)c3)cc2)c2ncn(CCCO)c2n1 |
| InChI | InChI=1S/C22H19ClN6O/c23-18-4-1-3-17(11-18)16-7-5-15(6-8-16)13-25-21-20-22(28-19(12-24)27-21)29(14-26-20)9-2-10-30/h1,3-8,11,14,30H,2,9-10,13H2,(H,25,27,28) |
| InChIKey | XVDFZQSDJGDASX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |