C23H23ClFN7O — CID 163215946
N-(2-amino-4-fluorophenyl)-4-[[6-(butylamino)-2-chloropurin-9-yl]methyl]benzamide (PubChem CID 163215946) has the molecular formula C23H23ClFN7O and a molecular weight of 467.94 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-4-[[6-(butylamino)-2-chloropurin-9-yl]methyl]benzamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-4-[[6-(butylamino)-2-chloropurin-9-yl]methyl]benzamide |
|---|---|
| PubChem CID | 163215946 |
| Molecular Formula | C23H23ClFN7O |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-4-[[6-(butylamino)-2-chloropurin-9-yl]methyl]benzamide |
| SMILES | CCCCNc1nc(Cl)nc2c1ncn2Cc1ccc(C(=O)Nc2ccc(F)cc2N)cc1 |
| InChI | InChI=1S/C23H23ClFN7O/c1-2-3-10-27-20-19-21(31-23(24)30-20)32(13-28-19)12-14-4-6-15(7-5-14)22(33)29-18-9-8-16(25)11-17(18)26/h4-9,11,13H,2-3,10,12,26H2,1H3,(H,29,33)(H,27,30,31) |
| InChIKey | KYYSORONVXCQRE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|