C18H24N8O — CID 44600929
5-[9-(2,2-dimethylpropyl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine (PubChem CID 44600929) has the molecular formula C18H24N8O and a molecular weight of 368.45 g/mol. Its IUPAC name is 5-[9-(2,2-dimethylpropyl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine.
| Compound Name | 5-[9-(2,2-dimethylpropyl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 44600929 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 5-[9-(2,2-dimethylpropyl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine |
| SMILES | CC(C)(C)Cn1cnc2c(-c3cnc(N)cn3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C18H24N8O/c1-18(2,3)10-26-11-22-15-14(12-8-21-13(19)9-20-12)23-17(24-16(15)26)25-4-6-27-7-5-25/h8-9,11H,4-7,10H2,1-3H3,(H2,19,21) |
| InChIKey | NNBTZXRCVKPZIC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |