C9H17N7OS — CID 10355835
5-amino-N'-ethyl-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide (PubChem CID 10355835) has the molecular formula C9H17N7OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 5-amino-N'-ethyl-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide.
| Compound Name | 5-amino-N'-ethyl-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide |
|---|---|
| PubChem CID | 10355835 |
| Molecular Formula | C9H17N7OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5-amino-N'-ethyl-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide |
| SMILES | CCNNC(=S)n1nc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C9H17N7OS/c1-2-11-13-9(18)16-7(10)12-8(14-16)15-3-5-17-6-4-15/h11H,2-6H2,1H3,(H,13,18)(H2,10,12,14) |
| InChIKey | YWNOYOJDDADIEK-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|