C17H24N6O3S — CID 19106560
2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-(3,4-dimethoxyphenyl)propanethioamide (PubChem CID 19106560) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-(3,4-dimethoxyphenyl)propanethioamide.
| Compound Name | 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-(3,4-dimethoxyphenyl)propanethioamide |
|---|---|
| PubChem CID | 19106560 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-(3,4-dimethoxyphenyl)propanethioamide |
| SMILES | COc1ccc(CC(C(N)=S)n2nc(N3CCOCC3)nc2N)cc1OC |
| InChI | InChI=1S/C17H24N6O3S/c1-24-13-4-3-11(10-14(13)25-2)9-12(15(18)27)23-16(19)20-17(21-23)22-5-7-26-8-6-22/h3-4,10,12H,5-9H2,1-2H3,(H2,18,27)(H2,19,20,21) |
| InChIKey | GHHDDZBHVUHAFX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|