C16H24N8OS — CID 10339502
5-[[4-(dimethylamino)phenyl]methylamino]-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide (PubChem CID 10339502) has the molecular formula C16H24N8OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]methylamino]-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide.
| Compound Name | 5-[[4-(dimethylamino)phenyl]methylamino]-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide |
|---|---|
| PubChem CID | 10339502 |
| Molecular Formula | C16H24N8OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]methylamino]-3-morpholin-4-yl-1,2,4-triazole-1-carbothiohydrazide |
| SMILES | CN(C)c1ccc(CNc2nc(N3CCOCC3)nn2C(=S)NN)cc1 |
| InChI | InChI=1S/C16H24N8OS/c1-22(2)13-5-3-12(4-6-13)11-18-14-19-15(21-24(14)16(26)20-17)23-7-9-25-10-8-23/h3-6H,7-11,17H2,1-2H3,(H,20,26)(H,18,19,21) |
| InChIKey | UNVLQBQHNITVKJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|