C12H18N8O3S — CID 2730938
N-[[[2-(5-morpholin-4-yltetrazol-2-yl)acetyl]amino]carbamothioyl]cyclopropanecarboxamide (PubChem CID 2730938) has the molecular formula C12H18N8O3S and a molecular weight of 354.40 g/mol. Its IUPAC name is N-[[[2-(5-morpholin-4-yltetrazol-2-yl)acetyl]amino]carbamothioyl]cyclopropanecarboxamide.
| Compound Name | N-[[[2-(5-morpholin-4-yltetrazol-2-yl)acetyl]amino]carbamothioyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 2730938 |
| Molecular Formula | C12H18N8O3S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[[[2-(5-morpholin-4-yltetrazol-2-yl)acetyl]amino]carbamothioyl]cyclopropanecarboxamide |
| SMILES | O=C(Cn1nnc(N2CCOCC2)n1)NNC(=S)NC(=O)C1CC1 |
| InChI | InChI=1S/C12H18N8O3S/c21-9(14-16-12(24)13-10(22)8-1-2-8)7-20-17-11(15-18-20)19-3-5-23-6-4-19/h8H,1-7H2,(H,14,21)(H2,13,16,22,24) |
| InChIKey | JERFIKNBWBHEQX-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|