C18H25N7O3 — CID 90595407
N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-2-(5-morpholin-4-yltetrazol-2-yl)acetamide (PubChem CID 90595407) has the molecular formula C18H25N7O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-2-(5-morpholin-4-yltetrazol-2-yl)acetamide.
| Compound Name | N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-2-(5-morpholin-4-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 90595407 |
| Molecular Formula | C18H25N7O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-2-(5-morpholin-4-yltetrazol-2-yl)acetamide |
| SMILES | COC1CCN(c2ccc(NC(=O)Cn3nnc(N4CCOCC4)n3)cc2)C1 |
| InChI | InChI=1S/C18H25N7O3/c1-27-16-6-7-24(12-16)15-4-2-14(3-5-15)19-17(26)13-25-21-18(20-22-25)23-8-10-28-11-9-23/h2-5,16H,6-13H2,1H3,(H,19,26) |
| InChIKey | UPIHQQZSESBDCE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|