C14H18N8O — CID 2730068
2-(5-piperidin-1-yltetrazol-2-yl)-N-(pyridin-4-ylmethylideneamino)acetamide (PubChem CID 2730068) has the molecular formula C14H18N8O and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-(5-piperidin-1-yltetrazol-2-yl)-N-(pyridin-4-ylmethylideneamino)acetamide.
| Compound Name | 2-(5-piperidin-1-yltetrazol-2-yl)-N-(pyridin-4-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 2730068 |
| Molecular Formula | C14H18N8O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(5-piperidin-1-yltetrazol-2-yl)-N-(pyridin-4-ylmethylideneamino)acetamide |
| SMILES | O=C(Cn1nnc(N2CCCCC2)n1)NN=Cc1ccncc1 |
| InChI | InChI=1S/C14H18N8O/c23-13(17-16-10-12-4-6-15-7-5-12)11-22-19-14(18-20-22)21-8-2-1-3-9-21/h4-7,10H,1-3,8-9,11H2,(H,17,23) |
| InChIKey | FMHXOQHOYDUWTQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|