C12H16N4OS — CID 139238171
N-(pyridin-4-ylmethylideneamino)-2-thiomorpholin-4-ylacetamide (PubChem CID 139238171) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is N-(pyridin-4-ylmethylideneamino)-2-thiomorpholin-4-ylacetamide.
| Compound Name | N-(pyridin-4-ylmethylideneamino)-2-thiomorpholin-4-ylacetamide |
|---|---|
| PubChem CID | 139238171 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-(pyridin-4-ylmethylideneamino)-2-thiomorpholin-4-ylacetamide |
| SMILES | O=C(CN1CCSCC1)NN=Cc1ccncc1 |
| InChI | InChI=1S/C12H16N4OS/c17-12(10-16-5-7-18-8-6-16)15-14-9-11-1-3-13-4-2-11/h1-4,9H,5-8,10H2,(H,15,17) |
| InChIKey | CORRPACZRCHMPC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|