C14H16F3N3OS — CID 5338386
2-thiomorpholin-4-yl-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 5338386) has the molecular formula C14H16F3N3OS and a molecular weight of 331.36 g/mol. Its IUPAC name is 2-thiomorpholin-4-yl-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-thiomorpholin-4-yl-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5338386 |
| Molecular Formula | C14H16F3N3OS |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-thiomorpholin-4-yl-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CN1CCSCC1)N/N=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N3OS/c15-14(16,17)12-3-1-11(2-4-12)9-18-19-13(21)10-20-5-7-22-8-6-20/h1-4,9H,5-8,10H2,(H,19,21)/b18-9+ |
| InChIKey | NPPRWDMRKZBCAM-GIJQJNRQSA-N |
| XLogP | 2.20 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|