C14H16ClN7O — CID 2730086
N-[(4-chlorophenyl)methylideneamino]-2-(5-pyrrolidin-1-yltetrazol-2-yl)acetamide (PubChem CID 2730086) has the molecular formula C14H16ClN7O and a molecular weight of 333.78 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-2-(5-pyrrolidin-1-yltetrazol-2-yl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-2-(5-pyrrolidin-1-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2730086 |
| Molecular Formula | C14H16ClN7O |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-2-(5-pyrrolidin-1-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(N2CCCC2)n1)NN=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN7O/c15-12-5-3-11(4-6-12)9-16-17-13(23)10-22-19-14(18-20-22)21-7-1-2-8-21/h3-6,9H,1-2,7-8,10H2,(H,17,23) |
| InChIKey | BOYBVDWPQVVGRU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|