C10H9Cl2N7O — CID 948248
2-(5-aminotetrazol-2-yl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 948248) has the molecular formula C10H9Cl2N7O and a molecular weight of 314.14 g/mol. Its IUPAC name is 2-(5-aminotetrazol-2-yl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-aminotetrazol-2-yl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 948248 |
| Molecular Formula | C10H9Cl2N7O |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-(5-aminotetrazol-2-yl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | Nc1nnn(CC(=O)NN=Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H9Cl2N7O/c11-7-2-1-6(8(12)3-7)4-14-15-9(20)5-19-17-10(13)16-18-19/h1-4H,5H2,(H2,13,17)(H,15,20) |
| InChIKey | CKUVDVXYYBSALD-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|