C26H28N6O2 — CID 59506517
4-[3-benzyl-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-yl]morpholine (PubChem CID 59506517) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 4-[3-benzyl-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-yl]morpholine.
| Compound Name | 4-[3-benzyl-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-yl]morpholine |
|---|---|
| PubChem CID | 59506517 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-[3-benzyl-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-yl]morpholine |
| SMILES | COc1ccc(CN2CCc3nn(Cc4ccccc4)c4nc(N5CCOCC5)nc2c34)cc1 |
| InChI | InChI=1S/C26H28N6O2/c1-33-21-9-7-20(8-10-21)17-31-12-11-22-23-24(31)27-26(30-13-15-34-16-14-30)28-25(23)32(29-22)18-19-5-3-2-4-6-19/h2-10H,11-18H2,1H3 |
| InChIKey | MPKCYEZEVQBMQO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |