C31H32N6O2 — CID 59506489
3-benzyl-N-[2-(3-methoxyphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine (PubChem CID 59506489) has the molecular formula C31H32N6O2 and a molecular weight of 520.64 g/mol. Its IUPAC name is 3-benzyl-N-[2-(3-methoxyphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine.
| Compound Name | 3-benzyl-N-[2-(3-methoxyphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 59506489 |
| Molecular Formula | C31H32N6O2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 3-benzyl-N-[2-(3-methoxyphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
| SMILES | COc1ccc(CN2CCc3nn(Cc4ccccc4)c4nc(NCCc5cccc(OC)c5)nc2c34)cc1 |
| InChI | InChI=1S/C31H32N6O2/c1-38-25-13-11-24(12-14-25)20-36-18-16-27-28-29(36)33-31(32-17-15-22-9-6-10-26(19-22)39-2)34-30(28)37(35-27)21-23-7-4-3-5-8-23/h3-14,19H,15-18,20-21H2,1-2H3,(H,32,33,34) |
| InChIKey | KAKMUHVWQFLHJS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |