C22H24N6O — CID 67544403
9-benzyl-N-[(3-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine (PubChem CID 67544403) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 9-benzyl-N-[(3-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine.
| Compound Name | 9-benzyl-N-[(3-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine |
|---|---|
| PubChem CID | 67544403 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 9-benzyl-N-[(3-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine |
| SMILES | COc1cccc(CNc2nc3c4c(n2)N(Cc2ccccc2)CCC4NN3)c1 |
| InChI | InChI=1S/C22H24N6O/c1-29-17-9-5-8-16(12-17)13-23-22-24-20-19-18(26-27-20)10-11-28(21(19)25-22)14-15-6-3-2-4-7-15/h2-9,12,18,26H,10-11,13-14H2,1H3,(H2,23,24,25,27) |
| InChIKey | GIZGIUQEMVJYAV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |