C28H27N7O — CID 59506452
3-benzyl-9-[(4-methoxyphenyl)methyl]-N-(pyridin-3-ylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine (PubChem CID 59506452) has the molecular formula C28H27N7O and a molecular weight of 477.57 g/mol. Its IUPAC name is 3-benzyl-9-[(4-methoxyphenyl)methyl]-N-(pyridin-3-ylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine.
| Compound Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-N-(pyridin-3-ylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 59506452 |
| Molecular Formula | C28H27N7O |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-N-(pyridin-3-ylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
| SMILES | COc1ccc(CN2CCc3nn(Cc4ccccc4)c4nc(NCc5cccnc5)nc2c34)cc1 |
| InChI | InChI=1S/C28H27N7O/c1-36-23-11-9-21(10-12-23)18-34-15-13-24-25-26(34)31-28(30-17-22-8-5-14-29-16-22)32-27(25)35(33-24)19-20-6-3-2-4-7-20/h2-12,14,16H,13,15,17-19H2,1H3,(H,30,31,32) |
| InChIKey | IOLQARQMWXEFNW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |