C15H14N4OS — CID 141204023
3-[(4-methoxyphenyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene (PubChem CID 141204023) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene |
|---|---|
| PubChem CID | 141204023 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene |
| SMILES | COc1ccc(Cn2nc3c4c(ncnc42)SCC3)cc1 |
| InChI | InChI=1S/C15H14N4OS/c1-20-11-4-2-10(3-5-11)8-19-14-13-12(18-19)6-7-21-15(13)17-9-16-14/h2-5,9H,6-8H2,1H3 |
| InChIKey | YRQKUVLKSJJAHJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |