C28H34N6O — CID 70843309
N-[2-(2,3-diethylphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-3-methyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine (PubChem CID 70843309) has the molecular formula C28H34N6O and a molecular weight of 470.62 g/mol. Its IUPAC name is N-[2-(2,3-diethylphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-3-methyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine.
| Compound Name | N-[2-(2,3-diethylphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-3-methyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 70843309 |
| Molecular Formula | C28H34N6O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | N-[2-(2,3-diethylphenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-3-methyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
| SMILES | CCc1cccc(CCNc2nc3c4c(nn(C)c4n2)CCN3Cc2ccc(OC)cc2)c1CC |
| InChI | InChI=1S/C28H34N6O/c1-5-20-8-7-9-21(23(20)6-2)14-16-29-28-30-26-25-24(32-33(26)3)15-17-34(27(25)31-28)18-19-10-12-22(35-4)13-11-19/h7-13H,5-6,14-18H2,1-4H3,(H,29,30,31) |
| InChIKey | UMQURKFNBQUBLQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |