C23H23FN6O — CID 59506429
N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine (PubChem CID 59506429) has the molecular formula C23H23FN6O and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 59506429 |
| Molecular Formula | C23H23FN6O |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
| SMILES | COc1ccc(CN2CCc3[nH]nc4nc(NCCc5ccc(F)cc5)nc2c34)cc1 |
| InChI | InChI=1S/C23H23FN6O/c1-31-18-8-4-16(5-9-18)14-30-13-11-19-20-21(29-28-19)26-23(27-22(20)30)25-12-10-15-2-6-17(24)7-3-15/h2-9H,10-14H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | LWILJNWJGAGLEZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |