C24H25FN6O — CID 46932036
N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraen-6-amine (PubChem CID 46932036) has the molecular formula C24H25FN6O and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraen-6-amine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 46932036 |
| Molecular Formula | C24H25FN6O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraen-6-amine |
| SMILES | COc1ccc(CN2CCCc3[nH]nc4nc(NCCc5ccc(F)cc5)nc2c34)cc1 |
| InChI | InChI=1S/C24H25FN6O/c1-32-19-10-6-17(7-11-19)15-31-14-2-3-20-21-22(30-29-20)27-24(28-23(21)31)26-13-12-16-4-8-18(25)9-5-16/h4-11H,2-3,12-15H2,1H3,(H2,26,27,28,29,30) |
| InChIKey | IJKQBJDFWXMPRY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |