C21H23N7 — CID 67544402
9-benzyl-N-(2-pyridin-3-ylethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine (PubChem CID 67544402) has the molecular formula C21H23N7 and a molecular weight of 373.46 g/mol. Its IUPAC name is 9-benzyl-N-(2-pyridin-3-ylethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine.
| Compound Name | 9-benzyl-N-(2-pyridin-3-ylethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine |
|---|---|
| PubChem CID | 67544402 |
| Molecular Formula | C21H23N7 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 9-benzyl-N-(2-pyridin-3-ylethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine |
| SMILES | c1ccc(CN2CCC3NNc4nc(NCCc5cccnc5)nc2c43)cc1 |
| InChI | InChI=1S/C21H23N7/c1-2-5-16(6-3-1)14-28-12-9-17-18-19(27-26-17)24-21(25-20(18)28)23-11-8-15-7-4-10-22-13-15/h1-7,10,13,17,26H,8-9,11-12,14H2,(H2,23,24,25,27) |
| InChIKey | YJFJLHIBUVXUSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |