C12H15N5 — CID 114448192
5,6-dimethyl-N-(2-pyridin-3-ylethyl)-1,2,4-triazin-3-amine (PubChem CID 114448192) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 5,6-dimethyl-N-(2-pyridin-3-ylethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-(2-pyridin-3-ylethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114448192 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 5,6-dimethyl-N-(2-pyridin-3-ylethyl)-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCCc2cccnc2)nc1C |
| InChI | InChI=1S/C12H15N5/c1-9-10(2)16-17-12(15-9)14-7-5-11-4-3-6-13-8-11/h3-4,6,8H,5,7H2,1-2H3,(H,14,15,17) |
| InChIKey | NNWBOXJFCXVWFA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |