C14H16N4O2 — CID 114786014
3-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]ethyl]benzoic acid (PubChem CID 114786014) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]ethyl]benzoic acid.
| Compound Name | 3-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 114786014 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]ethyl]benzoic acid |
| SMILES | Cc1nnc(NCCc2cccc(C(=O)O)c2)nc1C |
| InChI | InChI=1S/C14H16N4O2/c1-9-10(2)17-18-14(16-9)15-7-6-11-4-3-5-12(8-11)13(19)20/h3-5,8H,6-7H2,1-2H3,(H,19,20)(H,15,16,18) |
| InChIKey | TZYXMPMOMBKZOT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |