C18H18N4O — CID 167757226
4-methyl-6-phenoxy-N-(2-pyridin-3-ylethyl)pyrimidin-2-amine (PubChem CID 167757226) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-methyl-6-phenoxy-N-(2-pyridin-3-ylethyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-6-phenoxy-N-(2-pyridin-3-ylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 167757226 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-methyl-6-phenoxy-N-(2-pyridin-3-ylethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(Oc2ccccc2)nc(NCCc2cccnc2)n1 |
| InChI | InChI=1S/C18H18N4O/c1-14-12-17(23-16-7-3-2-4-8-16)22-18(21-14)20-11-9-15-6-5-10-19-13-15/h2-8,10,12-13H,9,11H2,1H3,(H,20,21,22) |
| InChIKey | RBXYOSHKGNYYCR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |