C25H30N8 — CID 67544314
9-benzyl-6-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene (PubChem CID 67544314) has the molecular formula C25H30N8 and a molecular weight of 442.57 g/mol. Its IUPAC name is 9-benzyl-6-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene.
| Compound Name | 9-benzyl-6-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene |
|---|---|
| PubChem CID | 67544314 |
| Molecular Formula | C25H30N8 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 9-benzyl-6-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene |
| SMILES | c1ccc(CN2CCC3NNc4nc(N5CCN(CCc6ccncc6)CC5)nc2c43)cc1 |
| InChI | InChI=1S/C25H30N8/c1-2-4-20(5-3-1)18-33-13-9-21-22-23(30-29-21)27-25(28-24(22)33)32-16-14-31(15-17-32)12-8-19-6-10-26-11-7-19/h1-7,10-11,21,29H,8-9,12-18H2,(H,27,28,30) |
| InChIKey | JRSRYICPNALYBF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |