C24H27N7 — CID 67544471
9-benzyl-6-(4-phenylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene (PubChem CID 67544471) has the molecular formula C24H27N7 and a molecular weight of 413.53 g/mol. Its IUPAC name is 9-benzyl-6-(4-phenylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene.
| Compound Name | 9-benzyl-6-(4-phenylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene |
|---|---|
| PubChem CID | 67544471 |
| Molecular Formula | C24H27N7 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 9-benzyl-6-(4-phenylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene |
| SMILES | c1ccc(CN2CCC3NNc4nc(N5CCN(c6ccccc6)CC5)nc2c43)cc1 |
| InChI | InChI=1S/C24H27N7/c1-3-7-18(8-4-1)17-31-12-11-20-21-22(28-27-20)25-24(26-23(21)31)30-15-13-29(14-16-30)19-9-5-2-6-10-19/h1-10,20,27H,11-17H2,(H,25,26,28) |
| InChIKey | WALKMEIAPHKUJG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |