C27H31N3O2 — CID 68572538
2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one (PubChem CID 68572538) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one.
| Compound Name | 2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 68572538 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
| SMILES | O=C(C1CC=CC2CCN(Cc3ccccc3)C(=O)C21)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O2/c31-26(29-18-16-28(17-19-29)23-11-5-2-6-12-23)24-13-7-10-22-14-15-30(27(32)25(22)24)20-21-8-3-1-4-9-21/h1-12,22,24-25H,13-20H2 |
| InChIKey | WQKLKJKVWBVHIK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|