C23H29NO3 — CID 70839754
cyclohexyl (8S)-2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate (PubChem CID 70839754) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is cyclohexyl (8S)-2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate.
| Compound Name | cyclohexyl (8S)-2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 70839754 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | cyclohexyl (8S)-2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
| SMILES | O=C(OC1CCCCC1)[C@H]1CC=CC2CCN(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C23H29NO3/c25-22-21-18(14-15-24(22)16-17-8-3-1-4-9-17)10-7-13-20(21)23(26)27-19-11-5-2-6-12-19/h1,3-4,7-10,18-21H,2,5-6,11-16H2/t18?,20-,21?/m0/s1 |
| InChIKey | BHLKGDJZXKAIGA-CKHPTIKVSA-N |
| XLogP | 4.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|