C25H24ClF2NO3 — CID 90989191
[4-chloro-3-(1,1-difluoroethyl)phenyl] 2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate (PubChem CID 90989191) has the molecular formula C25H24ClF2NO3 and a molecular weight of 459.92 g/mol. Its IUPAC name is [4-chloro-3-(1,1-difluoroethyl)phenyl] 2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate.
| Compound Name | [4-chloro-3-(1,1-difluoroethyl)phenyl] 2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 90989191 |
| Molecular Formula | C25H24ClF2NO3 |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [4-chloro-3-(1,1-difluoroethyl)phenyl] 2-benzyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
| SMILES | CC(F)(F)c1cc(OC(=O)C2CC=CC3CCN(Cc4ccccc4)C(=O)C32)ccc1Cl |
| InChI | InChI=1S/C25H24ClF2NO3/c1-25(27,28)20-14-18(10-11-21(20)26)32-24(31)19-9-5-8-17-12-13-29(23(30)22(17)19)15-16-6-3-2-4-7-16/h2-8,10-11,14,17,19,22H,9,12-13,15H2,1H3 |
| InChIKey | PSVVRHRCYTWSLW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|