C21H24ClF3N2O2 — CID 24747360
(4aS,8R,8aS)-2-butyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 24747360) has the molecular formula C21H24ClF3N2O2 and a molecular weight of 428.88 g/mol. Its IUPAC name is (4aS,8R,8aS)-2-butyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | (4aS,8R,8aS)-2-butyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 24747360 |
| Molecular Formula | C21H24ClF3N2O2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (4aS,8R,8aS)-2-butyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | CCCCN1CC[C@H]2C=CC[C@@H](C(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)[C@H]2C1=O |
| InChI | InChI=1S/C21H24ClF3N2O2/c1-2-3-10-27-11-9-13-5-4-6-15(18(13)20(27)29)19(28)26-14-7-8-17(22)16(12-14)21(23,24)25/h4-5,7-8,12-13,15,18H,2-3,6,9-11H2,1H3,(H,26,28)/t13-,15-,18+/m1/s1 |
| InChIKey | XMWXHLFPBITOEW-SIIHOXLZSA-N |
| XLogP | 5.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|