C25H24ClF3N2O — CID 89079045
(8S)-2-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methylidene-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 89079045) has the molecular formula C25H24ClF3N2O and a molecular weight of 460.93 g/mol. Its IUPAC name is (8S)-2-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methylidene-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | (8S)-2-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methylidene-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 89079045 |
| Molecular Formula | C25H24ClF3N2O |
| Molecular Weight | 460.93 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (8S)-2-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methylidene-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | C=C1C2C(C=CC[C@@H]2C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C25H24ClF3N2O/c1-16-23-18(12-13-31(16)15-17-6-3-2-4-7-17)8-5-9-20(23)24(32)30-19-10-11-22(26)21(14-19)25(27,28)29/h2-8,10-11,14,18,20,23H,1,9,12-13,15H2,(H,30,32)/t18?,20-,23?/m0/s1 |
| InChIKey | HVUBXBLIYQSIGN-WWAKMMQFSA-N |
| XLogP | 6.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.93 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|