C17H15BrF3NO3 — CID 45255120
(4aS,8R,8aS)-N-[4-bromo-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide (PubChem CID 45255120) has the molecular formula C17H15BrF3NO3 and a molecular weight of 418.21 g/mol. Its IUPAC name is (4aS,8R,8aS)-N-[4-bromo-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide.
| Compound Name | (4aS,8R,8aS)-N-[4-bromo-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide |
|---|---|
| PubChem CID | 45255120 |
| Molecular Formula | C17H15BrF3NO3 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | (4aS,8R,8aS)-N-[4-bromo-3-(trifluoromethyl)phenyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide |
| SMILES | O=C1OCC[C@H]2C=CC[C@@H](C(=O)Nc3ccc(Br)c(C(F)(F)F)c3)[C@@H]12 |
| InChI | InChI=1S/C17H15BrF3NO3/c18-13-5-4-10(8-12(13)17(19,20)21)22-15(23)11-3-1-2-9-6-7-25-16(24)14(9)11/h1-2,4-5,8-9,11,14H,3,6-7H2,(H,22,23)/t9-,11-,14+/m1/s1 |
| InChIKey | FVWGTVFISKRGEM-UDZFHETQSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|