C17H18N2O4 — CID 70839838
(4aS,8aS)-N-(2-carbamoylphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide (PubChem CID 70839838) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (4aS,8aS)-N-(2-carbamoylphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide.
| Compound Name | (4aS,8aS)-N-(2-carbamoylphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide |
|---|---|
| PubChem CID | 70839838 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (4aS,8aS)-N-(2-carbamoylphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)C1CC=C[C@@H]2CCOC(=O)[C@H]12 |
| InChI | InChI=1S/C17H18N2O4/c18-15(20)11-5-1-2-7-13(11)19-16(21)12-6-3-4-10-8-9-23-17(22)14(10)12/h1-5,7,10,12,14H,6,8-9H2,(H2,18,20)(H,19,21)/t10-,12?,14+/m1/s1 |
| InChIKey | CWNUCZHOMSAUBT-HDDSUISISA-N |
| XLogP | 1.48 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|