C20H27NO3 — CID 59529019
(4aS,8R,8aS)-N-(1-adamantyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide (PubChem CID 59529019) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (4aS,8R,8aS)-N-(1-adamantyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide.
| Compound Name | (4aS,8R,8aS)-N-(1-adamantyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide |
|---|---|
| PubChem CID | 59529019 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (4aS,8R,8aS)-N-(1-adamantyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxamide |
| SMILES | O=C1OCC[C@H]2C=CC[C@@H](C(=O)NC34CC5CC(CC(C5)C3)C4)[C@@H]12 |
| InChI | InChI=1S/C20H27NO3/c22-18(16-3-1-2-15-4-5-24-19(23)17(15)16)21-20-9-12-6-13(10-20)8-14(7-12)11-20/h1-2,12-17H,3-11H2,(H,21,22)/t12?,13?,14?,15-,16-,17+,20?/m1/s1 |
| InChIKey | QXLBTZAMLNTVQC-SXBGJTEFSA-N |
| XLogP | 2.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|