C18H25NO5 — CID 7251643
[(3R)-2-oxooxolan-3-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7251643) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7251643 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)O[C@@H]1CCOC1=O |
| InChI | InChI=1S/C18H25NO5/c20-15(19-10-16(21)24-14-1-2-23-17(14)22)9-18-6-11-3-12(7-18)5-13(4-11)8-18/h11-14H,1-10H2,(H,19,20)/t11?,12?,13?,14-,18?/m1/s1 |
| InChIKey | DKQMACMPSSMWFE-UDMGLPGGSA-N |
| XLogP | 1.57 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |