C22H26ClNO3 — CID 75103726
(3-chlorophenyl) 2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate (PubChem CID 75103726) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is (3-chlorophenyl) 2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate.
| Compound Name | (3-chlorophenyl) 2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 75103726 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (3-chlorophenyl) 2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1)C1CC=CC2CCN(C3CCCCC3)C(=O)C21 |
| InChI | InChI=1S/C22H26ClNO3/c23-16-7-5-10-18(14-16)27-22(26)19-11-4-6-15-12-13-24(21(25)20(15)19)17-8-2-1-3-9-17/h4-7,10,14-15,17,19-20H,1-3,8-9,11-13H2 |
| InChIKey | YFMXWLZYULKULE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|