C19H27N3O2S — CID 91609770
2-cyclohexyl-N-(2,5-dihydro-1,3-thiazol-2-yl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 91609770) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-cyclohexyl-N-(2,5-dihydro-1,3-thiazol-2-yl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | 2-cyclohexyl-N-(2,5-dihydro-1,3-thiazol-2-yl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 91609770 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-cyclohexyl-N-(2,5-dihydro-1,3-thiazol-2-yl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | O=C(NC1N=CCS1)C1CC=CC2CCN(C3CCCCC3)C(=O)C21 |
| InChI | InChI=1S/C19H27N3O2S/c23-17(21-19-20-10-12-25-19)15-8-4-5-13-9-11-22(18(24)16(13)15)14-6-2-1-3-7-14/h4-5,10,13-16,19H,1-3,6-9,11-12H2,(H,21,23) |
| InChIKey | FUAWLHZBQPUNSZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|