C19H23NO5 — CID 59529023
(4aS,8R,8aS)-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid (PubChem CID 59529023) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (4aS,8R,8aS)-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid.
| Compound Name | (4aS,8R,8aS)-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 59529023 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (4aS,8R,8aS)-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid |
| SMILES | COc1ccc(CN2CC[C@H]3C=CC[C@@H](C(=O)O)[C@H]3C2=O)cc1OC |
| InChI | InChI=1S/C19H23NO5/c1-24-15-7-6-12(10-16(15)25-2)11-20-9-8-13-4-3-5-14(19(22)23)17(13)18(20)21/h3-4,6-7,10,13-14,17H,5,8-9,11H2,1-2H3,(H,22,23)/t13-,14-,17+/m1/s1 |
| InChIKey | DTZAJVAQVWFENG-CPUCHLNUSA-N |
| XLogP | 2.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|