C24H25ClN2O2 — CID 70839842
(8S)-N-[(3-chloro-4-methylphenyl)methyl]-1-oxo-2-phenyl-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 70839842) has the molecular formula C24H25ClN2O2 and a molecular weight of 408.93 g/mol. Its IUPAC name is (8S)-N-[(3-chloro-4-methylphenyl)methyl]-1-oxo-2-phenyl-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | (8S)-N-[(3-chloro-4-methylphenyl)methyl]-1-oxo-2-phenyl-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 70839842 |
| Molecular Formula | C24H25ClN2O2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (8S)-N-[(3-chloro-4-methylphenyl)methyl]-1-oxo-2-phenyl-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | Cc1ccc(CNC(=O)[C@H]2CC=CC3CCN(c4ccccc4)C(=O)C32)cc1Cl |
| InChI | InChI=1S/C24H25ClN2O2/c1-16-10-11-17(14-21(16)25)15-26-23(28)20-9-5-6-18-12-13-27(24(29)22(18)20)19-7-3-2-4-8-19/h2-8,10-11,14,18,20,22H,9,12-13,15H2,1H3,(H,26,28)/t18?,20-,22?/m0/s1 |
| InChIKey | KUPWTKUNPHBNRJ-JGBTYHIZSA-N |
| XLogP | 4.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|