C22H26ClN5O5 — CID 10254376
N'-[(9S)-2-[(3-chloro-4-methylphenyl)methylcarbamoyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidin-9-yl]-N,N,N'-trimethyloxamide (PubChem CID 10254376) has the molecular formula C22H26ClN5O5 and a molecular weight of 475.93 g/mol. Its IUPAC name is N'-[(9S)-2-[(3-chloro-4-methylphenyl)methylcarbamoyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidin-9-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[(9S)-2-[(3-chloro-4-methylphenyl)methylcarbamoyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidin-9-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 10254376 |
| Molecular Formula | C22H26ClN5O5 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N'-[(9S)-2-[(3-chloro-4-methylphenyl)methylcarbamoyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidin-9-yl]-N,N,N'-trimethyloxamide |
| SMILES | Cc1ccc(CNC(=O)C2N=C3[C@@H](N(C)C(=O)C(=O)N(C)C)CCCN3C(=O)C2=O)cc1Cl |
| InChI | InChI=1S/C22H26ClN5O5/c1-12-7-8-13(10-14(12)23)11-24-19(30)16-17(29)20(31)28-9-5-6-15(18(28)25-16)27(4)22(33)21(32)26(2)3/h7-8,10,15-16H,5-6,9,11H2,1-4H3,(H,24,30)/t15-,16?/m0/s1 |
| InChIKey | NXJLBUDYGRLOIY-VYRBHSGPSA-N |
| XLogP | 0.15 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|