C19H26ClN5O — CID 165119858
1-[(3-chloro-4-methylphenyl)methyl]-3-methylurea;3-piperidin-1-ylpyridazine (PubChem CID 165119858) has the molecular formula C19H26ClN5O and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-[(3-chloro-4-methylphenyl)methyl]-3-methylurea;3-piperidin-1-ylpyridazine.
| Compound Name | 1-[(3-chloro-4-methylphenyl)methyl]-3-methylurea;3-piperidin-1-ylpyridazine |
|---|---|
| PubChem CID | 165119858 |
| Molecular Formula | C19H26ClN5O |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-[(3-chloro-4-methylphenyl)methyl]-3-methylurea;3-piperidin-1-ylpyridazine |
| SMILES | CNC(=O)NCc1ccc(C)c(Cl)c1.c1cnnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C10H13ClN2O.C9H13N3/c1-7-3-4-8(5-9(7)11)6-13-10(14)12-2;1-2-7-12(8-3-1)9-5-4-6-10-11-9/h3-5H,6H2,1-2H3,(H2,12,13,14);4-6H,1-3,7-8H2 |
| InChIKey | BIXNZPGDLDZWAP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |