C22H29N5O — CID 165119785
1-methyl-3-(naphthalen-2-ylmethyl)urea;molecular hydrogen;3-piperidin-1-ylpyridazine (PubChem CID 165119785) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-methyl-3-(naphthalen-2-ylmethyl)urea;molecular hydrogen;3-piperidin-1-ylpyridazine.
| Compound Name | 1-methyl-3-(naphthalen-2-ylmethyl)urea;molecular hydrogen;3-piperidin-1-ylpyridazine |
|---|---|
| PubChem CID | 165119785 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-methyl-3-(naphthalen-2-ylmethyl)urea;molecular hydrogen;3-piperidin-1-ylpyridazine |
| SMILES | CNC(=O)NCc1ccc2ccccc2c1.[H][H].c1cnnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C13H14N2O.C9H13N3.H2/c1-14-13(16)15-9-10-6-7-11-4-2-3-5-12(11)8-10;1-2-7-12(8-3-1)9-5-4-6-10-11-9;/h2-8H,9H2,1H3,(H2,14,15,16);4-6H,1-3,7-8H2;1H |
| InChIKey | ZKJQIYLVMFDFAX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |