About 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine
1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine (PubChem CID 165119967) has the molecular formula C20H25Cl2N5O
and a molecular weight of 422.36 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine.
Molecular Properties
| Compound Name | 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine |
| PubChem CID | 165119967 |
| Molecular Formula | C20H25Cl2N5O |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine |
| SMILES | CNC(=O)NC1CC1c1ccc(Cl)cc1Cl.c1cnnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C11H12Cl2N2O.C9H13N3/c1-14-11(16)15-10-5-8(10)7-3-2-6(12)4-9(7)13;1-2-7-12(8-3-1)9-5-4-6-10-11-9/h2-4,8,10H,5H2,1H3,(H2,14,15,16);4-6H,1-3,7-8H2 |
| InChIKey | CSRXTZARZAOZPF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine?
The IUPAC name of 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine (CID 165119967) is 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine.
What is the SMILES notation for 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine?
The canonical SMILES for 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine is CNC(=O)NC1CC1c1ccc(Cl)cc1Cl.c1cnnc(N2CCCCC2)c1.
What is the InChIKey of 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine?
The InChIKey is CSRXTZARZAOZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O.C9H13N3/c1-14-11(16)15-10-5-8(10)7-3-2-6(12)4-9(7)13;1-2-7-12(8-3-1)9-5-4-6-10-11-9/h2-4,8,10H,5H2,1H3,(H2,14,15,16);4-6H,1-3,7-8H2.
What are the key properties of 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine?
1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine has a molecular weight of 422.36 g/mol, XLogP of 4.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dichlorophenyl)cyclopropyl]-3-methylurea;3-piperidin-1-ylpyridazine is sourced from PubChem (CID 165119967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).