C19H29N5O — CID 165119475
1-methyl-3-[(3-methylphenyl)methyl]urea;molecular hydrogen;3-piperidin-1-ylpyridazine (PubChem CID 165119475) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 1-methyl-3-[(3-methylphenyl)methyl]urea;molecular hydrogen;3-piperidin-1-ylpyridazine.
| Compound Name | 1-methyl-3-[(3-methylphenyl)methyl]urea;molecular hydrogen;3-piperidin-1-ylpyridazine |
|---|---|
| PubChem CID | 165119475 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 1-methyl-3-[(3-methylphenyl)methyl]urea;molecular hydrogen;3-piperidin-1-ylpyridazine |
| SMILES | CNC(=O)NCc1cccc(C)c1.[H][H].c1cnnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C10H14N2O.C9H13N3.H2/c1-8-4-3-5-9(6-8)7-12-10(13)11-2;1-2-7-12(8-3-1)9-5-4-6-10-11-9;/h3-6H,7H2,1-2H3,(H2,11,12,13);4-6H,1-3,7-8H2;1H |
| InChIKey | VNXRZOUODTWJBG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |