C23H21FN8O4 — CID 10368383
N-[(4-fluorophenyl)methyl]-9-[methyl([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide (PubChem CID 10368383) has the molecular formula C23H21FN8O4 and a molecular weight of 492.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-9-[methyl([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-9-[methyl([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 10368383 |
| Molecular Formula | C23H21FN8O4 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-9-[methyl([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide |
| SMILES | CN(C(=O)c1nc2ncccn2n1)C1CCCN2C(=O)C(=O)C(C(=O)NCc3ccc(F)cc3)N=C12 |
| InChI | InChI=1S/C23H21FN8O4/c1-30(22(36)18-28-23-25-9-3-11-32(23)29-18)15-4-2-10-31-19(15)27-16(17(33)21(31)35)20(34)26-12-13-5-7-14(24)8-6-13/h3,5-9,11,15-16H,2,4,10,12H2,1H3,(H,26,34) |
| InChIKey | XRDXSWYWUZUJFR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|