C24H31FN6O7S — CID 11757666
9-[dimethylsulfamoyl-(2-morpholin-4-yl-2-oxoethyl)amino]-N-[(4-fluorophenyl)methyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide (PubChem CID 11757666) has the molecular formula C24H31FN6O7S and a molecular weight of 566.61 g/mol. Its IUPAC name is 9-[dimethylsulfamoyl-(2-morpholin-4-yl-2-oxoethyl)amino]-N-[(4-fluorophenyl)methyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide.
| Compound Name | 9-[dimethylsulfamoyl-(2-morpholin-4-yl-2-oxoethyl)amino]-N-[(4-fluorophenyl)methyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 11757666 |
| Molecular Formula | C24H31FN6O7S |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 9-[dimethylsulfamoyl-(2-morpholin-4-yl-2-oxoethyl)amino]-N-[(4-fluorophenyl)methyl]-3,4-dioxo-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)N1CCOCC1)C1CCCN2C(=O)C(=O)C(C(=O)NCc3ccc(F)cc3)N=C12 |
| InChI | InChI=1S/C24H31FN6O7S/c1-28(2)39(36,37)31(15-19(32)29-10-12-38-13-11-29)18-4-3-9-30-22(18)27-20(21(33)24(30)35)23(34)26-14-16-5-7-17(25)8-6-16/h5-8,18,20H,3-4,9-15H2,1-2H3,(H,26,34) |
| InChIKey | BNVXSLRZRLODSC-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|