C26H24F4N4O4 — CID 11756842
(9R)-N-[(4-fluorophenyl)methyl]-3,4-dioxo-9-[[(1S)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide (PubChem CID 11756842) has the molecular formula C26H24F4N4O4 and a molecular weight of 532.49 g/mol. Its IUPAC name is (9R)-N-[(4-fluorophenyl)methyl]-3,4-dioxo-9-[[(1S)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide.
| Compound Name | (9R)-N-[(4-fluorophenyl)methyl]-3,4-dioxo-9-[[(1S)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 11756842 |
| Molecular Formula | C26H24F4N4O4 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | (9R)-N-[(4-fluorophenyl)methyl]-3,4-dioxo-9-[[(1S)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-6,7,8,9-tetrahydro-2H-pyrido[1,2-a]pyrimidine-2-carboxamide |
| SMILES | C[C@@H](c1ccccc1)N(C(=O)C(F)(F)F)[C@@H]1CCCN2C(=O)C(=O)C(C(=O)NCc3ccc(F)cc3)N=C12 |
| InChI | InChI=1S/C26H24F4N4O4/c1-15(17-6-3-2-4-7-17)34(25(38)26(28,29)30)19-8-5-13-33-22(19)32-20(21(35)24(33)37)23(36)31-14-16-9-11-18(27)12-10-16/h2-4,6-7,9-12,15,19-20H,5,8,13-14H2,1H3,(H,31,36)/t15-,19+,20?/m0/s1 |
| InChIKey | XSSZFFGKOHHSJM-SXBLTQOBSA-N |
| XLogP | 2.93 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|